C27H38F3N3O5Si — CID 173250177
benzyl N-[1-[2-[[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 173250177) has the molecular formula C27H38F3N3O5Si and a molecular weight of 569.70 g/mol. Its IUPAC name is benzyl N-[1-[2-[[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | benzyl N-[1-[2-[[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 173250177 |
| Molecular Formula | C27H38F3N3O5Si |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | benzyl N-[1-[2-[[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CC(C)C(NC(=O)Cn1cccc(NC(=O)OCc2ccccc2)c1=O)(O[SiH](C)C)C(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C27H38F3N3O5Si/c1-18(2)26(38-39(6)7,23(25(3,4)5)27(28,29)30)32-21(34)16-33-15-11-14-20(22(33)35)31-24(36)37-17-19-12-9-8-10-13-19/h8-15,18,23,39H,16-17H2,1-7H3,(H,31,36)(H,32,34) |
| InChIKey | SLWCCIJOOPGZCQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|