C27H37F3IN3O5Si — CID 67747642
benzyl N-[1-[2-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]amino]-2-oxoethyl]-5-iodo-2-oxo-3-pyridinyl]carbamate (PubChem CID 67747642) has the molecular formula C27H37F3IN3O5Si and a molecular weight of 695.59 g/mol. Its IUPAC name is benzyl N-[1-[2-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]amino]-2-oxoethyl]-5-iodo-2-oxo-3-pyridinyl]carbamate.
| Compound Name | benzyl N-[1-[2-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]amino]-2-oxoethyl]-5-iodo-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 67747642 |
| Molecular Formula | C27H37F3IN3O5Si |
| Molecular Weight | 695.59 g/mol |
| Exact Mass | 695.15 |
| IUPAC Name | benzyl N-[1-[2-[[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoro-4-methylpentan-3-yl]amino]-2-oxoethyl]-5-iodo-2-oxo-3-pyridinyl]carbamate |
| SMILES | CC(C)C(CC(F)(F)F)(NC(=O)Cn1cc(I)cc(NC(=O)OCc2ccccc2)c1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H37F3IN3O5Si/c1-18(2)26(17-27(28,29)30,39-40(6,7)25(3,4)5)33-22(35)15-34-14-20(31)13-21(23(34)36)32-24(37)38-16-19-11-9-8-10-12-19/h8-14,18H,15-17H2,1-7H3,(H,32,37)(H,33,35) |
| InChIKey | OAYONZQDKYPIQW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|