C25H30FNO6 — CID 101123837
ditert-butyl 2-[5-fluoro-2-(phenylmethoxycarbonylamino)phenyl]propanedioate (PubChem CID 101123837) has the molecular formula C25H30FNO6 and a molecular weight of 459.51 g/mol. Its IUPAC name is ditert-butyl 2-[5-fluoro-2-(phenylmethoxycarbonylamino)phenyl]propanedioate.
| Compound Name | ditert-butyl 2-[5-fluoro-2-(phenylmethoxycarbonylamino)phenyl]propanedioate |
|---|---|
| PubChem CID | 101123837 |
| Molecular Formula | C25H30FNO6 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | ditert-butyl 2-[5-fluoro-2-(phenylmethoxycarbonylamino)phenyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)c1cc(F)ccc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H30FNO6/c1-24(2,3)32-21(28)20(22(29)33-25(4,5)6)18-14-17(26)12-13-19(18)27-23(30)31-15-16-10-8-7-9-11-16/h7-14,20H,15H2,1-6H3,(H,27,30) |
| InChIKey | YSXKIEFRGGTDHN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|