C14H15N3O4 — CID 70699902
benzyl N-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)carbamate (PubChem CID 70699902) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is benzyl N-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)carbamate.
| Compound Name | benzyl N-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)carbamate |
|---|---|
| PubChem CID | 70699902 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | benzyl N-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)carbamate |
| SMILES | Cn1cc(NC(=O)OCc2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H15N3O4/c1-16-8-11(12(18)17(2)14(16)20)15-13(19)21-9-10-6-4-3-5-7-10/h3-8H,9H2,1-2H3,(H,15,19) |
| InChIKey | YVIIFANSLALIDM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |