C24H22N2O5 — CID 174378849
methyl 2-[2-oxo-6-(2-phenylethenyl)-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate (PubChem CID 174378849) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is methyl 2-[2-oxo-6-(2-phenylethenyl)-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate.
| Compound Name | methyl 2-[2-oxo-6-(2-phenylethenyl)-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 174378849 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | methyl 2-[2-oxo-6-(2-phenylethenyl)-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate |
| SMILES | COC(=O)Cn1c(C=Cc2ccccc2)ccc(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C24H22N2O5/c1-30-22(27)16-26-20(13-12-18-8-4-2-5-9-18)14-15-21(23(26)28)25-24(29)31-17-19-10-6-3-7-11-19/h2-15H,16-17H2,1H3,(H,25,29) |
| InChIKey | UYXWWDGHMAAFLZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |