C23H22N2O6 — CID 70186119
methyl 2-[6-methyl-2-oxo-4-phenoxy-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate (PubChem CID 70186119) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 2-[6-methyl-2-oxo-4-phenoxy-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate.
| Compound Name | methyl 2-[6-methyl-2-oxo-4-phenoxy-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 70186119 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | methyl 2-[6-methyl-2-oxo-4-phenoxy-3-(phenylmethoxycarbonylamino)-1-pyridinyl]acetate |
| SMILES | COC(=O)Cn1c(C)cc(Oc2ccccc2)c(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C23H22N2O6/c1-16-13-19(31-18-11-7-4-8-12-18)21(22(27)25(16)14-20(26)29-2)24-23(28)30-15-17-9-5-3-6-10-17/h3-13H,14-15H2,1-2H3,(H,24,28) |
| InChIKey | MXWZLXHPZORAIE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |