C17H20N2O6S — CID 131862352
benzyl N-[4-(methanesulfonamido)-2,6-dimethoxyphenyl]carbamate (PubChem CID 131862352) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is benzyl N-[4-(methanesulfonamido)-2,6-dimethoxyphenyl]carbamate.
| Compound Name | benzyl N-[4-(methanesulfonamido)-2,6-dimethoxyphenyl]carbamate |
|---|---|
| PubChem CID | 131862352 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | benzyl N-[4-(methanesulfonamido)-2,6-dimethoxyphenyl]carbamate |
| SMILES | COc1cc(NS(C)(=O)=O)cc(OC)c1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O6S/c1-23-14-9-13(19-26(3,21)22)10-15(24-2)16(14)18-17(20)25-11-12-7-5-4-6-8-12/h4-10,19H,11H2,1-3H3,(H,18,20) |
| InChIKey | LNSJWSWLKOWZGL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |