C15H16N2O4 — CID 142143785
benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate (PubChem CID 142143785) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate.
| Compound Name | benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 142143785 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NO)cc1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16N2O4/c1-20-14-8-7-12(17-19)9-13(14)16-15(18)21-10-11-5-3-2-4-6-11/h2-9,17,19H,10H2,1H3,(H,16,18) |
| InChIKey | FHIDZJKJDKHYCS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|