benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate

C15H16N2O4 — CID 142143785

IUPACbenzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate
SMILESCOc1ccc(NO)cc1NC(=O)OCc1ccccc1
InChIInChI=1S/C15H16N2O4/c1-20-14-8-7-12(17-19)9-13(14)16-15(18)21-10-11-5-3-2-4-6-11/h2-9,17,19H,10H2,1H3,(H,16,18)
InChIKeyFHIDZJKJDKHYCS-UHFFFAOYSA-N
MW288.30 g/mol
LogP3.24
Rot. Bonds5

About benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate

benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate (PubChem CID 142143785) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate.

Molecular Properties

Compound Namebenzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate
PubChem CID142143785
Molecular FormulaC15H16N2O4
Molecular Weight288.30 g/mol
Exact Mass288.11
IUPAC Namebenzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate
SMILESCOc1ccc(NO)cc1NC(=O)OCc1ccccc1
InChIInChI=1S/C15H16N2O4/c1-20-14-8-7-12(17-19)9-13(14)16-15(18)21-10-11-5-3-2-4-6-11/h2-9,17,19H,10H2,1H3,(H,16,18)
InChIKeyFHIDZJKJDKHYCS-UHFFFAOYSA-N
XLogP3.24
TPSA79.82 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.30
LogP ≤ 53.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate?
The IUPAC name of benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate (CID 142143785) is benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate.
What is the SMILES notation for benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate?
The canonical SMILES for benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate is COc1ccc(NO)cc1NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate?
The InChIKey is FHIDZJKJDKHYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4/c1-20-14-8-7-12(17-19)9-13(14)16-15(18)21-10-11-5-3-2-4-6-11/h2-9,17,19H,10H2,1H3,(H,16,18).
What are the key properties of benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate?
benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate has a molecular weight of 288.30 g/mol, XLogP of 3.24, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[5-(hydroxyamino)-2-methoxyphenyl]carbamate is sourced from PubChem (CID 142143785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).