C17H18N2O5 — CID 70300379
benzyl N-(2-carbamoyl-4,6-dimethoxyphenyl)carbamate (PubChem CID 70300379) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is benzyl N-(2-carbamoyl-4,6-dimethoxyphenyl)carbamate.
| Compound Name | benzyl N-(2-carbamoyl-4,6-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 70300379 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | benzyl N-(2-carbamoyl-4,6-dimethoxyphenyl)carbamate |
| SMILES | COc1cc(OC)c(NC(=O)OCc2ccccc2)c(C(N)=O)c1 |
| InChI | InChI=1S/C17H18N2O5/c1-22-12-8-13(16(18)20)15(14(9-12)23-2)19-17(21)24-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | XPFFKPBFHDXTKV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |