C27H30N2O6 — CID 132941117
benzyl N-[(1S,2S)-2-benzamido-1-(2,4,6-trimethoxyphenyl)propyl]carbamate (PubChem CID 132941117) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-2-benzamido-1-(2,4,6-trimethoxyphenyl)propyl]carbamate.
| Compound Name | benzyl N-[(1S,2S)-2-benzamido-1-(2,4,6-trimethoxyphenyl)propyl]carbamate |
|---|---|
| PubChem CID | 132941117 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | benzyl N-[(1S,2S)-2-benzamido-1-(2,4,6-trimethoxyphenyl)propyl]carbamate |
| SMILES | COc1cc(OC)c([C@H](NC(=O)OCc2ccccc2)[C@H](C)NC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H30N2O6/c1-18(28-26(30)20-13-9-6-10-14-20)25(29-27(31)35-17-19-11-7-5-8-12-19)24-22(33-3)15-21(32-2)16-23(24)34-4/h5-16,18,25H,17H2,1-4H3,(H,28,30)(H,29,31)/t18-,25+/m0/s1 |
| InChIKey | QRVQEDBZIQSIFY-AVRWGWEMSA-N |
| XLogP | 4.50 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |