C19H22N2O4 — CID 67174902
benzyl N-[3-[(2-hydroxybenzoyl)amino]butan-2-yl]carbamate (PubChem CID 67174902) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is benzyl N-[3-[(2-hydroxybenzoyl)amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[3-[(2-hydroxybenzoyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 67174902 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | benzyl N-[3-[(2-hydroxybenzoyl)amino]butan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(C)NC(=O)c1ccccc1O |
| InChI | InChI=1S/C19H22N2O4/c1-13(20-18(23)16-10-6-7-11-17(16)22)14(2)21-19(24)25-12-15-8-4-3-5-9-15/h3-11,13-14,22H,12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | CYMNCVFKEYBRPG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |