C20H17N3O4 — CID 10361338
benzyl N-[6-oxo-1-(2-oxoethyl)-2-phenylpyrimidin-5-yl]carbamate (PubChem CID 10361338) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is benzyl N-[6-oxo-1-(2-oxoethyl)-2-phenylpyrimidin-5-yl]carbamate.
| Compound Name | benzyl N-[6-oxo-1-(2-oxoethyl)-2-phenylpyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 10361338 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | benzyl N-[6-oxo-1-(2-oxoethyl)-2-phenylpyrimidin-5-yl]carbamate |
| SMILES | O=CCn1c(-c2ccccc2)ncc(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C20H17N3O4/c24-12-11-23-18(16-9-5-2-6-10-16)21-13-17(19(23)25)22-20(26)27-14-15-7-3-1-4-8-15/h1-10,12-13H,11,14H2,(H,22,26) |
| InChIKey | YHBUHBUMVBCLKV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|