C27H35N3O5Si — CID 142664856
benzyl N-[1-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyethyl]-2-(2-methylphenyl)-6-oxopyrimidin-5-yl]carbamate (PubChem CID 142664856) has the molecular formula C27H35N3O5Si and a molecular weight of 509.68 g/mol. Its IUPAC name is benzyl N-[1-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyethyl]-2-(2-methylphenyl)-6-oxopyrimidin-5-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyethyl]-2-(2-methylphenyl)-6-oxopyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 142664856 |
| Molecular Formula | C27H35N3O5Si |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | benzyl N-[1-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyethyl]-2-(2-methylphenyl)-6-oxopyrimidin-5-yl]carbamate |
| SMILES | Cc1ccccc1-c1ncc(NC(=O)OCc2ccccc2)c(=O)n1CC(O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H35N3O5Si/c1-19-12-10-11-15-21(19)24-28-16-22(29-26(33)34-18-20-13-8-7-9-14-20)25(32)30(24)17-23(31)35-36(5,6)27(2,3)4/h7-16,23,31H,17-18H2,1-6H3,(H,29,33) |
| InChIKey | AIQXSQLOAGNBJF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|