C28H35BN4O6S — CID 10030836
benzyl N-[1-[2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-2-oxoethyl]-6-oxo-2-thiophen-2-ylpyrimidin-5-yl]carbamate (PubChem CID 10030836) has the molecular formula C28H35BN4O6S and a molecular weight of 566.49 g/mol. Its IUPAC name is benzyl N-[1-[2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-2-oxoethyl]-6-oxo-2-thiophen-2-ylpyrimidin-5-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-2-oxoethyl]-6-oxo-2-thiophen-2-ylpyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 10030836 |
| Molecular Formula | C28H35BN4O6S |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | benzyl N-[1-[2-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-2-oxoethyl]-6-oxo-2-thiophen-2-ylpyrimidin-5-yl]carbamate |
| SMILES | CC(C)C(NC(=O)Cn1c(-c2cccs2)ncc(NC(=O)OCc2ccccc2)c1=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C28H35BN4O6S/c1-18(2)23(29-38-27(3,4)28(5,6)39-29)32-22(34)16-33-24(21-13-10-14-40-21)30-15-20(25(33)35)31-26(36)37-17-19-11-8-7-9-12-19/h7-15,18,23H,16-17H2,1-6H3,(H,31,36)(H,32,34) |
| InChIKey | WHPLKBAOCALWOA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|