C26H24F3N5O7 — CID 10415744
benzyl N-[2-(4-nitrophenyl)-6-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]pyrimidin-5-yl]carbamate (PubChem CID 10415744) has the molecular formula C26H24F3N5O7 and a molecular weight of 575.50 g/mol. Its IUPAC name is benzyl N-[2-(4-nitrophenyl)-6-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]pyrimidin-5-yl]carbamate.
| Compound Name | benzyl N-[2-(4-nitrophenyl)-6-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 10415744 |
| Molecular Formula | C26H24F3N5O7 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | benzyl N-[2-(4-nitrophenyl)-6-oxo-1-[2-oxo-2-[(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)amino]ethyl]pyrimidin-5-yl]carbamate |
| SMILES | CC(C)C(NC(=O)Cn1c(-c2ccc([N+](=O)[O-])cc2)ncc(NC(=O)OCc2ccccc2)c1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C26H24F3N5O7/c1-15(2)21(22(36)26(27,28)29)32-20(35)13-33-23(17-8-10-18(11-9-17)34(39)40)30-12-19(24(33)37)31-25(38)41-14-16-6-4-3-5-7-16/h3-12,15,21H,13-14H2,1-2H3,(H,31,38)(H,32,35) |
| InChIKey | ODLRISNJPYHISY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|