C21H19N3O5 — CID 151530111
[2-(4-methylphenyl)-6-oxo-5-(phenylmethoxycarbonylamino)pyrimidin-1-yl] acetate (PubChem CID 151530111) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is [2-(4-methylphenyl)-6-oxo-5-(phenylmethoxycarbonylamino)pyrimidin-1-yl] acetate.
| Compound Name | [2-(4-methylphenyl)-6-oxo-5-(phenylmethoxycarbonylamino)pyrimidin-1-yl] acetate |
|---|---|
| PubChem CID | 151530111 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [2-(4-methylphenyl)-6-oxo-5-(phenylmethoxycarbonylamino)pyrimidin-1-yl] acetate |
| SMILES | CC(=O)On1c(-c2ccc(C)cc2)ncc(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C21H19N3O5/c1-14-8-10-17(11-9-14)19-22-12-18(20(26)24(19)29-15(2)25)23-21(27)28-13-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3,(H,23,27) |
| InChIKey | PWHFBFFUQHBXFE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |