C13H13N3O3 — CID 11161253
benzyl N-(2-methyl-6-oxo-1H-pyrimidin-5-yl)carbamate (PubChem CID 11161253) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is benzyl N-(2-methyl-6-oxo-1H-pyrimidin-5-yl)carbamate.
| Compound Name | benzyl N-(2-methyl-6-oxo-1H-pyrimidin-5-yl)carbamate |
|---|---|
| PubChem CID | 11161253 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | benzyl N-(2-methyl-6-oxo-1H-pyrimidin-5-yl)carbamate |
| SMILES | Cc1ncc(NC(=O)OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H13N3O3/c1-9-14-7-11(12(17)15-9)16-13(18)19-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,16,18)(H,14,15,17) |
| InChIKey | WNWDXVOYBNCHHM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |