C20H18N2O3 — CID 22405456
benzyl N-(6-methyl-2-oxo-5-phenyl-1H-pyridin-3-yl)carbamate (PubChem CID 22405456) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is benzyl N-(6-methyl-2-oxo-5-phenyl-1H-pyridin-3-yl)carbamate.
| Compound Name | benzyl N-(6-methyl-2-oxo-5-phenyl-1H-pyridin-3-yl)carbamate |
|---|---|
| PubChem CID | 22405456 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | benzyl N-(6-methyl-2-oxo-5-phenyl-1H-pyridin-3-yl)carbamate |
| SMILES | Cc1[nH]c(=O)c(NC(=O)OCc2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C20H18N2O3/c1-14-17(16-10-6-3-7-11-16)12-18(19(23)21-14)22-20(24)25-13-15-8-4-2-5-9-15/h2-12H,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | GIZSXFFTXSJJQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |