C33H36N6O9 — CID 118585539
benzyl N-[2-[2,4,6-trioxo-3,5-bis[2-(phenylmethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]ethyl]carbamate (PubChem CID 118585539) has the molecular formula C33H36N6O9 and a molecular weight of 660.68 g/mol. Its IUPAC name is benzyl N-[2-[2,4,6-trioxo-3,5-bis[2-(phenylmethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2,4,6-trioxo-3,5-bis[2-(phenylmethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 118585539 |
| Molecular Formula | C33H36N6O9 |
| Molecular Weight | 660.68 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | benzyl N-[2-[2,4,6-trioxo-3,5-bis[2-(phenylmethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]ethyl]carbamate |
| SMILES | O=C(NCCn1c(=O)n(CCNC(=O)OCc2ccccc2)c(=O)n(CCNC(=O)OCc2ccccc2)c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H36N6O9/c40-28(46-22-25-10-4-1-5-11-25)34-16-19-37-31(43)38(20-17-35-29(41)47-23-26-12-6-2-7-13-26)33(45)39(32(37)44)21-18-36-30(42)48-24-27-14-8-3-9-15-27/h1-15H,16-24H2,(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | OFVRPBKXUASRMX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 180.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|