C30H46F3N3O3Si — CID 173250234
N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[2-oxo-3-(pentylamino)-6-phenyl-1-pyridinyl]acetamide (PubChem CID 173250234) has the molecular formula C30H46F3N3O3Si and a molecular weight of 581.80 g/mol. Its IUPAC name is N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[2-oxo-3-(pentylamino)-6-phenyl-1-pyridinyl]acetamide.
| Compound Name | N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[2-oxo-3-(pentylamino)-6-phenyl-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 173250234 |
| Molecular Formula | C30H46F3N3O3Si |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[2-oxo-3-(pentylamino)-6-phenyl-1-pyridinyl]acetamide |
| SMILES | CCCCCNc1ccc(-c2ccccc2)n(CC(=O)NC(O[SiH](C)C)(C(C)C)C(C(C)(C)C)C(F)(F)F)c1=O |
| InChI | InChI=1S/C30H46F3N3O3Si/c1-9-10-14-19-34-23-17-18-24(22-15-12-11-13-16-22)36(26(23)38)20-25(37)35-29(21(2)3,39-40(7)8)27(28(4,5)6)30(31,32)33/h11-13,15-18,21,27,34,40H,9-10,14,19-20H2,1-8H3,(H,35,37) |
| InChIKey | DZBKUJMMJMOXQF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|