C30H32F2N4O5 — CID 19695840
4-[[2-(3-acetamido-2-oxo-6-phenyl-1-pyridinyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide (PubChem CID 19695840) has the molecular formula C30H32F2N4O5 and a molecular weight of 566.61 g/mol. Its IUPAC name is 4-[[2-(3-acetamido-2-oxo-6-phenyl-1-pyridinyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide.
| Compound Name | 4-[[2-(3-acetamido-2-oxo-6-phenyl-1-pyridinyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 19695840 |
| Molecular Formula | C30H32F2N4O5 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 4-[[2-(3-acetamido-2-oxo-6-phenyl-1-pyridinyl)acetyl]amino]-2,2-difluoro-5-methyl-3-oxo-N-(2-phenylethyl)hexanamide |
| SMILES | CC(=O)Nc1ccc(-c2ccccc2)n(CC(=O)NC(C(=O)C(F)(F)C(=O)NCCc2ccccc2)C(C)C)c1=O |
| InChI | InChI=1S/C30H32F2N4O5/c1-19(2)26(27(39)30(31,32)29(41)33-17-16-21-10-6-4-7-11-21)35-25(38)18-36-24(22-12-8-5-9-13-22)15-14-23(28(36)40)34-20(3)37/h4-15,19,26H,16-18H2,1-3H3,(H,33,41)(H,34,37)(H,35,38) |
| InChIKey | CXRJUGQSFKAJPW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|