C32H40F3N4O5Si — CID 67747645
CID 67747645 (PubChem CID 67747645) has the molecular formula C32H40F3N4O5Si and a molecular weight of 645.78 g/mol.
| Compound Name | CID 67747645 |
|---|---|
| PubChem CID | 67747645 |
| Molecular Formula | C32H40F3N4O5Si |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | — |
| SMILES | CC(C)C(NC(=O)Cn1c(-c2ccccc2)ccc(NC(=O)OCc2ccncc2)c1=O)(O[Si](C)C)C(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C32H40F3N4O5Si/c1-21(2)31(44-45(6)7,28(30(3,4)5)32(33,34)35)38-26(40)19-39-25(23-11-9-8-10-12-23)14-13-24(27(39)41)37-29(42)43-20-22-15-17-36-18-16-22/h8-18,21,28H,19-20H2,1-7H3,(H,37,42)(H,38,40) |
| InChIKey | UWCWAUKRASKQLG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|