C30H41F3N3O7Si — CID 70086300
CID 70086300 (PubChem CID 70086300) has the molecular formula C30H41F3N3O7Si and a molecular weight of 640.75 g/mol.
| Compound Name | CID 70086300 |
|---|---|
| PubChem CID | 70086300 |
| Molecular Formula | C30H41F3N3O7Si |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1ccn(CC(=O)NC(O[Si](C)C)(C(C)C)C(C(C)(C)C)C(F)(F)F)c(=O)c1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H41F3N3O7Si/c1-9-41-25(39)21-15-16-36(24(38)23(21)34-27(40)42-18-20-13-11-10-12-14-20)17-22(37)35-29(19(2)3,43-44(7)8)26(28(4,5)6)30(31,32)33/h10-16,19,26H,9,17-18H2,1-8H3,(H,34,40)(H,35,37) |
| InChIKey | ZHYOQVMEZIVPBT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|