C31H41F3N6O4Si — CID 173364256
N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[6-oxo-2-phenyl-5-(pyridin-4-ylmethylcarbamoylamino)pyrimidin-1-yl]acetamide (PubChem CID 173364256) has the molecular formula C31H41F3N6O4Si and a molecular weight of 646.79 g/mol. Its IUPAC name is N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[6-oxo-2-phenyl-5-(pyridin-4-ylmethylcarbamoylamino)pyrimidin-1-yl]acetamide.
| Compound Name | N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[6-oxo-2-phenyl-5-(pyridin-4-ylmethylcarbamoylamino)pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 173364256 |
| Molecular Formula | C31H41F3N6O4Si |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | N-[3-dimethylsilyloxy-2,5,5-trimethyl-4-(trifluoromethyl)hexan-3-yl]-2-[6-oxo-2-phenyl-5-(pyridin-4-ylmethylcarbamoylamino)pyrimidin-1-yl]acetamide |
| SMILES | CC(C)C(NC(=O)Cn1c(-c2ccccc2)ncc(NC(=O)NCc2ccncc2)c1=O)(O[SiH](C)C)C(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C31H41F3N6O4Si/c1-20(2)30(44-45(6)7,27(29(3,4)5)31(32,33)34)39-24(41)19-40-25(22-11-9-8-10-12-22)36-18-23(26(40)42)38-28(43)37-17-21-13-15-35-16-14-21/h8-16,18,20,27,45H,17,19H2,1-7H3,(H,39,41)(H2,37,38,43) |
| InChIKey | JTBXIURVJZPRRM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|