C23H20N4O4 — CID 139925093
benzyl N-[1-[2-[(4-cyanophenyl)methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 139925093) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is benzyl N-[1-[2-[(4-cyanophenyl)methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | benzyl N-[1-[2-[(4-cyanophenyl)methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 139925093 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | benzyl N-[1-[2-[(4-cyanophenyl)methylamino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | N#Cc1ccc(CNC(=O)Cn2cccc(NC(=O)OCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C23H20N4O4/c24-13-17-8-10-18(11-9-17)14-25-21(28)15-27-12-4-7-20(22(27)29)26-23(30)31-16-19-5-2-1-3-6-19/h1-12H,14-16H2,(H,25,28)(H,26,30) |
| InChIKey | JHHXPHYDKSSEKT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |