C25H24N2O2S — CID 55766106
2-[(4-cyanophenyl)methylsulfanyl]-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide (PubChem CID 55766106) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfanyl]-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55766106 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[[4-(phenylmethoxymethyl)phenyl]methyl]acetamide |
| SMILES | N#Cc1ccc(CSCC(=O)NCc2ccc(COCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O2S/c26-14-20-6-12-24(13-7-20)18-30-19-25(28)27-15-21-8-10-23(11-9-21)17-29-16-22-4-2-1-3-5-22/h1-13H,15-19H2,(H,27,28) |
| InChIKey | JEGZWLMYYYMTQG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |