C15H15N5O3S — CID 120698338
2-[4-[[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698338) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-[4-[[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698338 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[4-[[[2-[(4-cyanophenyl)methylsulfanyl]acetyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | N#Cc1ccc(CSCC(=O)NCc2cn(CC(=O)O)nn2)cc1 |
| InChI | InChI=1S/C15H15N5O3S/c16-5-11-1-3-12(4-2-11)9-24-10-14(21)17-6-13-7-20(19-18-13)8-15(22)23/h1-4,7H,6,8-10H2,(H,17,21)(H,22,23) |
| InChIKey | XHNZCTKWBRFSDQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |