C10H9BrN4O4 — CID 113313813
2-[4-[[(5-bromofuran-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 113313813) has the molecular formula C10H9BrN4O4 and a molecular weight of 329.11 g/mol. Its IUPAC name is 2-[4-[[(5-bromofuran-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(5-bromofuran-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 113313813 |
| Molecular Formula | C10H9BrN4O4 |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2-[4-[[(5-bromofuran-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)c2ccc(Br)o2)nn1 |
| InChI | InChI=1S/C10H9BrN4O4/c11-8-2-1-7(19-8)10(18)12-3-6-4-15(14-13-6)5-9(16)17/h1-2,4H,3,5H2,(H,12,18)(H,16,17) |
| InChIKey | KCWLOLZJMIDUNR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |