C12H10Cl2N4O3 — CID 115457375
2-[4-[[(3,4-dichlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115457375) has the molecular formula C12H10Cl2N4O3 and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-[4-[[(3,4-dichlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(3,4-dichlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115457375 |
| Molecular Formula | C12H10Cl2N4O3 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[4-[[(3,4-dichlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)c2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C12H10Cl2N4O3/c13-9-2-1-7(3-10(9)14)12(21)15-4-8-5-18(17-16-8)6-11(19)20/h1-3,5H,4,6H2,(H,15,21)(H,19,20) |
| InChIKey | JXPFDDVSIGKUKZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |