C12H12ClN5O3 — CID 115458112
2-[4-[[(4-amino-3-chlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458112) has the molecular formula C12H12ClN5O3 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-[4-[[(4-amino-3-chlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(4-amino-3-chlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458112 |
| Molecular Formula | C12H12ClN5O3 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[4-[[(4-amino-3-chlorobenzoyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | Nc1ccc(C(=O)NCc2cn(CC(=O)O)nn2)cc1Cl |
| InChI | InChI=1S/C12H12ClN5O3/c13-9-3-7(1-2-10(9)14)12(21)15-4-8-5-18(17-16-8)6-11(19)20/h1-3,5H,4,6,14H2,(H,15,21)(H,19,20) |
| InChIKey | IRLYQFJAIOJIMP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|