C14H15ClN4O3S — CID 120698820
2-[4-[[(4-chloro-2-ethylsulfanylbenzoyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698820) has the molecular formula C14H15ClN4O3S and a molecular weight of 354.82 g/mol. Its IUPAC name is 2-[4-[[(4-chloro-2-ethylsulfanylbenzoyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(4-chloro-2-ethylsulfanylbenzoyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698820 |
| Molecular Formula | C14H15ClN4O3S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-[4-[[(4-chloro-2-ethylsulfanylbenzoyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CCSc1cc(Cl)ccc1C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C14H15ClN4O3S/c1-2-23-12-5-9(15)3-4-11(12)14(22)16-6-10-7-19(18-17-10)8-13(20)21/h3-5,7H,2,6,8H2,1H3,(H,16,22)(H,20,21) |
| InChIKey | URDXWXXWCXHRJY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |