C15H19N5O5S — CID 120698880
2-[4-[[[2-(propylsulfonylamino)benzoyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698880) has the molecular formula C15H19N5O5S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[4-[[[2-(propylsulfonylamino)benzoyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(propylsulfonylamino)benzoyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698880 |
| Molecular Formula | C15H19N5O5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[4-[[[2-(propylsulfonylamino)benzoyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CCCS(=O)(=O)Nc1ccccc1C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C15H19N5O5S/c1-2-7-26(24,25)18-13-6-4-3-5-12(13)15(23)16-8-11-9-20(19-17-11)10-14(21)22/h3-6,9,18H,2,7-8,10H2,1H3,(H,16,23)(H,21,22) |
| InChIKey | ZOLKIAUWYQFKEC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |