C12H14N4O4S — CID 115457920
2-[4-[(2-methylsulfonylanilino)methyl]triazol-1-yl]acetic acid (PubChem CID 115457920) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[4-[(2-methylsulfonylanilino)methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(2-methylsulfonylanilino)methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115457920 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[4-[(2-methylsulfonylanilino)methyl]triazol-1-yl]acetic acid |
| SMILES | CS(=O)(=O)c1ccccc1NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C12H14N4O4S/c1-21(19,20)11-5-3-2-4-10(11)13-6-9-7-16(15-14-9)8-12(17)18/h2-5,7,13H,6,8H2,1H3,(H,17,18) |
| InChIKey | WIXVPBSPAWSRET-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |