C10H12N6O2 — CID 83065169
2-[4-[[(3-methylpyrazin-2-yl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 83065169) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-[4-[[(3-methylpyrazin-2-yl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(3-methylpyrazin-2-yl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 83065169 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[4-[[(3-methylpyrazin-2-yl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | Cc1nccnc1NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C10H12N6O2/c1-7-10(12-3-2-11-7)13-4-8-5-16(15-14-8)6-9(17)18/h2-3,5H,4,6H2,1H3,(H,12,13)(H,17,18) |
| InChIKey | SAIYNEQWFCVMAH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |