C10H11ClN6O3 — CID 115457937
2-[4-[[(5-chloro-2-methoxypyrimidin-4-yl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115457937) has the molecular formula C10H11ClN6O3 and a molecular weight of 298.69 g/mol. Its IUPAC name is 2-[4-[[(5-chloro-2-methoxypyrimidin-4-yl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(5-chloro-2-methoxypyrimidin-4-yl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115457937 |
| Molecular Formula | C10H11ClN6O3 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[4-[[(5-chloro-2-methoxypyrimidin-4-yl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | COc1ncc(Cl)c(NCc2cn(CC(=O)O)nn2)n1 |
| InChI | InChI=1S/C10H11ClN6O3/c1-20-10-13-3-7(11)9(14-10)12-2-6-4-17(16-15-6)5-8(18)19/h3-4H,2,5H2,1H3,(H,18,19)(H,12,13,14) |
| InChIKey | LLDGIIGFWULSFQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |