C11H19N5O4 — CID 104763980
2-[4-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 104763980) has the molecular formula C11H19N5O4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[4-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 104763980 |
| Molecular Formula | C11H19N5O4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[4-[[(2-methoxy-2-methylpropyl)carbamoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | COC(C)(C)CNC(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C11H19N5O4/c1-11(2,20-3)7-13-10(19)12-4-8-5-16(15-14-8)6-9(17)18/h5H,4,6-7H2,1-3H3,(H,17,18)(H2,12,13,19) |
| InChIKey | MSJNVQJDZOSMHM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |