C11H18N6O4 — CID 115458538
2-[4-[[[2-oxo-2-(propylamino)ethyl]carbamoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458538) has the molecular formula C11H18N6O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-[4-[[[2-oxo-2-(propylamino)ethyl]carbamoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-oxo-2-(propylamino)ethyl]carbamoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458538 |
| Molecular Formula | C11H18N6O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[4-[[[2-oxo-2-(propylamino)ethyl]carbamoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | CCCNC(=O)CNC(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C11H18N6O4/c1-2-3-12-9(18)5-14-11(21)13-4-8-6-17(16-15-8)7-10(19)20/h6H,2-5,7H2,1H3,(H,12,18)(H,19,20)(H2,13,14,21) |
| InChIKey | VNGYQHNUDYPUKP-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |