C12H20N6O3 — CID 115458576
2-[4-[[3-(cyclopropylamino)propylcarbamoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458576) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[4-[[3-(cyclopropylamino)propylcarbamoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-(cyclopropylamino)propylcarbamoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458576 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-[4-[[3-(cyclopropylamino)propylcarbamoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)NCCCNC2CC2)nn1 |
| InChI | InChI=1S/C12H20N6O3/c19-11(20)8-18-7-10(16-17-18)6-15-12(21)14-5-1-4-13-9-2-3-9/h7,9,13H,1-6,8H2,(H,19,20)(H2,14,15,21) |
| InChIKey | NDVDOHIPSFJDID-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|