C12H19N5O3S — CID 115458793
2-[4-[[(2-methylthiolan-2-yl)methylcarbamoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458793) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-[4-[[(2-methylthiolan-2-yl)methylcarbamoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(2-methylthiolan-2-yl)methylcarbamoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458793 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[4-[[(2-methylthiolan-2-yl)methylcarbamoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | CC1(CNC(=O)NCc2cn(CC(=O)O)nn2)CCCS1 |
| InChI | InChI=1S/C12H19N5O3S/c1-12(3-2-4-21-12)8-14-11(20)13-5-9-6-17(16-15-9)7-10(18)19/h6H,2-5,7-8H2,1H3,(H,18,19)(H2,13,14,20) |
| InChIKey | YCRWGHFBPIOVNN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |