C10H12F3N5O3 — CID 106216398
2-[4-[[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 106216398) has the molecular formula C10H12F3N5O3 and a molecular weight of 307.23 g/mol. Its IUPAC name is 2-[4-[[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 106216398 |
| Molecular Formula | C10H12F3N5O3 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[4-[[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)NC2(C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C10H12F3N5O3/c11-10(12,13)9(1-2-9)15-8(21)14-3-6-4-18(17-16-6)5-7(19)20/h4H,1-3,5H2,(H,19,20)(H2,14,15,21) |
| InChIKey | MURBJFFCCQTNBQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |