C11H17N5O3 — CID 115458127
2-[4-[[[2-(1-aminocyclobutyl)acetyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458127) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-[4-[[[2-(1-aminocyclobutyl)acetyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(1-aminocyclobutyl)acetyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458127 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[4-[[[2-(1-aminocyclobutyl)acetyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | NC1(CC(=O)NCc2cn(CC(=O)O)nn2)CCC1 |
| InChI | InChI=1S/C11H17N5O3/c12-11(2-1-3-11)4-9(17)13-5-8-6-16(15-14-8)7-10(18)19/h6H,1-5,7,12H2,(H,13,17)(H,18,19) |
| InChIKey | JQTKHWFYBRDWEU-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |