C10H19N5O2 — CID 66269035
2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-N-propylacetamide (PubChem CID 66269035) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-N-propylacetamide.
| Compound Name | 2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 66269035 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNCc1cn(CCO)nn1 |
| InChI | InChI=1S/C10H19N5O2/c1-2-3-12-10(17)7-11-6-9-8-15(4-5-16)14-13-9/h8,11,16H,2-7H2,1H3,(H,12,17) |
| InChIKey | SPWUMKPSUANIFW-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |