C11H21N5O2 — CID 66270629
2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]-N-propan-2-ylacetamide (PubChem CID 66270629) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 66270629 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNCc1cn(CCCO)nn1 |
| InChI | InChI=1S/C11H21N5O2/c1-9(2)13-11(18)7-12-6-10-8-16(15-14-10)4-3-5-17/h8-9,12,17H,3-7H2,1-2H3,(H,13,18) |
| InChIKey | VKTIGHIXCXZIAT-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |