C9H18N4O2 — CID 66269866
2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]propan-1-ol (PubChem CID 66269866) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]propan-1-ol.
| Compound Name | 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 66269866 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]propan-1-ol |
| SMILES | CC(CO)NCc1cn(CCCO)nn1 |
| InChI | InChI=1S/C9H18N4O2/c1-8(7-15)10-5-9-6-13(12-11-9)3-2-4-14/h6,8,10,14-15H,2-5,7H2,1H3 |
| InChIKey | OMPCSRUJKNWMIZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |