C15H22N4O2 — CID 81367670
3-[4-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 81367670) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[4-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 81367670 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[4-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | COc1ccc([C@H](C)NCc2cn(CCCO)nn2)cc1 |
| InChI | InChI=1S/C15H22N4O2/c1-12(13-4-6-15(21-2)7-5-13)16-10-14-11-19(18-17-14)8-3-9-20/h4-7,11-12,16,20H,3,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | VYVIVXYRVVHTOJ-LBPRGKRZSA-N |
| XLogP | 1.52 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |