C12H24N4O — CID 66269304
3-[4-[(4-methylpentan-2-ylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 66269304) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-[4-[(4-methylpentan-2-ylamino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(4-methylpentan-2-ylamino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66269304 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 3-[4-[(4-methylpentan-2-ylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | CC(C)CC(C)NCc1cn(CCCO)nn1 |
| InChI | InChI=1S/C12H24N4O/c1-10(2)7-11(3)13-8-12-9-16(15-14-12)5-4-6-17/h9-11,13,17H,4-8H2,1-3H3 |
| InChIKey | YHBRXVKEFUKJBB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |