C14H27N5O — CID 66270310
3-[4-[[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 66270310) has the molecular formula C14H27N5O and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[4-[[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66270310 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 3-[4-[[(2-methyl-3-pyrrolidin-1-ylpropyl)amino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | CC(CNCc1cn(CCCO)nn1)CN1CCCC1 |
| InChI | InChI=1S/C14H27N5O/c1-13(11-18-5-2-3-6-18)9-15-10-14-12-19(17-16-14)7-4-8-20/h12-13,15,20H,2-11H2,1H3 |
| InChIKey | CAXGNAHNBZGJJG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |