C13H25N5O — CID 105415204
3-[4-[[[1-(dimethylamino)cyclobutyl]methylamino]methyl]triazol-1-yl]propan-1-ol (PubChem CID 105415204) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 3-[4-[[[1-(dimethylamino)cyclobutyl]methylamino]methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[[1-(dimethylamino)cyclobutyl]methylamino]methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 105415204 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 3-[4-[[[1-(dimethylamino)cyclobutyl]methylamino]methyl]triazol-1-yl]propan-1-ol |
| SMILES | CN(C)C1(CNCc2cn(CCCO)nn2)CCC1 |
| InChI | InChI=1S/C13H25N5O/c1-17(2)13(5-3-6-13)11-14-9-12-10-18(16-15-12)7-4-8-19/h10,14,19H,3-9,11H2,1-2H3 |
| InChIKey | XRGRUVGFMBSGGX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |