C9H16N4O3 — CID 66268145
methyl 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]acetate (PubChem CID 66268145) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is methyl 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]acetate.
| Compound Name | methyl 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]acetate |
|---|---|
| PubChem CID | 66268145 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | methyl 2-[[1-(3-hydroxypropyl)triazol-4-yl]methylamino]acetate |
| SMILES | COC(=O)CNCc1cn(CCCO)nn1 |
| InChI | InChI=1S/C9H16N4O3/c1-16-9(15)6-10-5-8-7-13(12-11-8)3-2-4-14/h7,10,14H,2-6H2,1H3 |
| InChIKey | GATACZFNSWTYBG-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |