C16H17N5O3 — CID 120697865
2-[4-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120697865) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[4-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120697865 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[4-[[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C16H17N5O3/c1-10-13(12-4-2-3-5-14(12)18-10)6-15(22)17-7-11-8-21(20-19-11)9-16(23)24/h2-5,8,18H,6-7,9H2,1H3,(H,17,22)(H,23,24) |
| InChIKey | GMISRGXSHSSBKF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|